C28H42O6 — CID 57064168
[(9S,10R,13R,14R,17R)-17-[1-(1,3-dioxolan-2-yl)ethyl]-3-(methoxymethoxy)-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-1-yl] acetate (PubChem CID 57064168) has the molecular formula C28H42O6 and a molecular weight of 474.64 g/mol. Its IUPAC name is [(9S,10R,13R,14R,17R)-17-[1-(1,3-dioxolan-2-yl)ethyl]-3-(methoxymethoxy)-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-1-yl] acetate.
| Compound Name | [(9S,10R,13R,14R,17R)-17-[1-(1,3-dioxolan-2-yl)ethyl]-3-(methoxymethoxy)-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-1-yl] acetate |
|---|---|
| PubChem CID | 57064168 |
| Molecular Formula | C28H42O6 |
| Molecular Weight | 474.64 g/mol |
| Exact Mass | 474.30 |
| IUPAC Name | [(9S,10R,13R,14R,17R)-17-[1-(1,3-dioxolan-2-yl)ethyl]-3-(methoxymethoxy)-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-1-yl] acetate |
| SMILES | COCOC1CC2=CC=C3[C@@H]4CC[C@H](C(C)C5OCCO5)[C@@]4(C)CC[C@@H]3[C@@]2(C)C(OC(C)=O)C1 |
| InChI | InChI=1S/C28H42O6/c1-17(26-31-12-13-32-26)22-8-9-23-21-7-6-19-14-20(33-16-30-5)15-25(34-18(2)29)28(19,4)24(21)10-11-27(22,23)3/h6-7,17,20,22-26H,8-16H2,1-5H3/t17?,20?,22-,23+,24+,25?,27-,28+/m1/s1 |
| InChIKey | DIXNUIUWWOEUMJ-OHXPWZHZSA-N |
| XLogP | 5.03 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.64 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|