C23H22N2O3S2 — CID 57064334
trans-[(R)-(2-benzyl-1,3-thiazol-5-yl)-cyanomethyl] (1R,3S)-2,2-dimethyl-3-[(2-oxothiolan-3-ylidene)methyl]cyclopropane-1-carboxylate (PubChem CID 57064334) has the molecular formula C23H22N2O3S2 and a molecular weight of 438.57 g/mol. Its IUPAC name is trans-[(R)-(2-benzyl-1,3-thiazol-5-yl)-cyanomethyl] (1R,3S)-2,2-dimethyl-3-[(2-oxothiolan-3-ylidene)methyl]cyclopropane-1-carboxylate.
| Compound Name | trans-[(R)-(2-benzyl-1,3-thiazol-5-yl)-cyanomethyl] (1R,3S)-2,2-dimethyl-3-[(2-oxothiolan-3-ylidene)methyl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 57064334 |
| Molecular Formula | C23H22N2O3S2 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.11 |
| IUPAC Name | trans-[(R)-(2-benzyl-1,3-thiazol-5-yl)-cyanomethyl] (1R,3S)-2,2-dimethyl-3-[(2-oxothiolan-3-ylidene)methyl]cyclopropane-1-carboxylate |
| SMILES | CC1(C)[C@H](C(=O)O[C@H](C#N)c2cnc(Cc3ccccc3)s2)[C@@H]1C=C1CCSC1=O |
| InChI | InChI=1S/C23H22N2O3S2/c1-23(2)16(11-15-8-9-29-22(15)27)20(23)21(26)28-17(12-24)18-13-25-19(30-18)10-14-6-4-3-5-7-14/h3-7,11,13,16-17,20H,8-10H2,1-2H3/t16-,17+,20-/m0/s1 |
| InChIKey | BDEUIMGDHHYJDY-QKLQHJQFSA-N |
| XLogP | 4.70 |
| TPSA | 80.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|