C11H20NO+ — CID 57064337
1,1-bis(prop-2-enyl)piperidin-1-ium-4-ol (PubChem CID 57064337) has the molecular formula C11H20NO+ and a molecular weight of 182.29 g/mol. Its IUPAC name is 1,1-bis(prop-2-enyl)piperidin-1-ium-4-ol.
| Compound Name | 1,1-bis(prop-2-enyl)piperidin-1-ium-4-ol |
|---|---|
| PubChem CID | 57064337 |
| Molecular Formula | C11H20NO+ |
| Molecular Weight | 182.29 g/mol |
| Exact Mass | 182.15 |
| IUPAC Name | 1,1-bis(prop-2-enyl)piperidin-1-ium-4-ol |
| SMILES | C=CC[N+]1(CC=C)CCC(O)CC1 |
| InChI | InChI=1S/C11H20NO/c1-3-7-12(8-4-2)9-5-11(13)6-10-12/h3-4,11,13H,1-2,5-10H2/q+1 |
| InChIKey | JDAWPKJOEUGSPB-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.29 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|