About N'-[[6-[(3-aminopropylamino)methyl]-2-pyridinyl]methyl]propane-1,3-diamine
N'-[[6-[(3-aminopropylamino)methyl]-2-pyridinyl]methyl]propane-1,3-diamine (PubChem CID 57064348) has the molecular formula C13H25N5
and a molecular weight of 251.38 g/mol. Its IUPAC name is N'-[[6-[(3-aminopropylamino)methyl]-2-pyridinyl]methyl]propane-1,3-diamine.
Molecular Properties
| Compound Name | N'-[[6-[(3-aminopropylamino)methyl]-2-pyridinyl]methyl]propane-1,3-diamine |
| PubChem CID | 57064348 |
| Molecular Formula | C13H25N5 |
| Molecular Weight | 251.38 g/mol |
| Exact Mass | 251.21 |
| IUPAC Name | N'-[[6-[(3-aminopropylamino)methyl]-2-pyridinyl]methyl]propane-1,3-diamine |
| SMILES | NCCCNCc1cccc(CNCCCN)n1 |
| InChI | InChI=1S/C13H25N5/c14-6-2-8-16-10-12-4-1-5-13(18-12)11-17-9-3-7-15/h1,4-5,16-17H,2-3,6-11,14-15H2 |
| InChIKey | MLCOQALRIWTHPQ-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 88.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.38 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N'-[[6-[(3-aminopropylamino)methyl]-2-pyridinyl]methyl]propane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[[6-[(3-aminopropylamino)methyl]-2-pyridinyl]methyl]propane-1,3-diamine?
The IUPAC name of N'-[[6-[(3-aminopropylamino)methyl]-2-pyridinyl]methyl]propane-1,3-diamine (CID 57064348) is N'-[[6-[(3-aminopropylamino)methyl]-2-pyridinyl]methyl]propane-1,3-diamine.
What is the SMILES notation for N'-[[6-[(3-aminopropylamino)methyl]-2-pyridinyl]methyl]propane-1,3-diamine?
The canonical SMILES for N'-[[6-[(3-aminopropylamino)methyl]-2-pyridinyl]methyl]propane-1,3-diamine is NCCCNCc1cccc(CNCCCN)n1.
What is the InChIKey of N'-[[6-[(3-aminopropylamino)methyl]-2-pyridinyl]methyl]propane-1,3-diamine?
The InChIKey is MLCOQALRIWTHPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25N5/c14-6-2-8-16-10-12-4-1-5-13(18-12)11-17-9-3-7-15/h1,4-5,16-17H,2-3,6-11,14-15H2.
What are the key properties of N'-[[6-[(3-aminopropylamino)methyl]-2-pyridinyl]methyl]propane-1,3-diamine?
N'-[[6-[(3-aminopropylamino)methyl]-2-pyridinyl]methyl]propane-1,3-diamine has a molecular weight of 251.38 g/mol, XLogP of -0.04, 10 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[[6-[(3-aminopropylamino)methyl]-2-pyridinyl]methyl]propane-1,3-diamine is sourced from PubChem (CID 57064348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).