About (4-prop-2-enylanilino) acetate
(4-prop-2-enylanilino) acetate (PubChem CID 57064388) has the molecular formula C11H13NO2
and a molecular weight of 191.23 g/mol. Its IUPAC name is (4-prop-2-enylanilino) acetate.
Molecular Properties
| Compound Name | (4-prop-2-enylanilino) acetate |
| PubChem CID | 57064388 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | (4-prop-2-enylanilino) acetate |
| SMILES | C=CCc1ccc(NOC(C)=O)cc1 |
| InChI | InChI=1S/C11H13NO2/c1-3-4-10-5-7-11(8-6-10)12-14-9(2)13/h3,5-8,12H,1,4H2,2H3 |
| InChIKey | FOSCFNIJHPMGED-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4-prop-2-enylanilino) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-prop-2-enylanilino) acetate?
The IUPAC name of (4-prop-2-enylanilino) acetate (CID 57064388) is (4-prop-2-enylanilino) acetate.
What is the SMILES notation for (4-prop-2-enylanilino) acetate?
The canonical SMILES for (4-prop-2-enylanilino) acetate is C=CCc1ccc(NOC(C)=O)cc1.
What is the InChIKey of (4-prop-2-enylanilino) acetate?
The InChIKey is FOSCFNIJHPMGED-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO2/c1-3-4-10-5-7-11(8-6-10)12-14-9(2)13/h3,5-8,12H,1,4H2,2H3.
What are the key properties of (4-prop-2-enylanilino) acetate?
(4-prop-2-enylanilino) acetate has a molecular weight of 191.23 g/mol, XLogP of 2.31, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-prop-2-enylanilino) acetate is sourced from PubChem (CID 57064388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).