About 3-(2,4-difluorophenyl)-N-[(1R)-1-thiophen-2-ylethyl]-1,2-oxazole-5-carboxamide
3-(2,4-difluorophenyl)-N-[(1R)-1-thiophen-2-ylethyl]-1,2-oxazole-5-carboxamide (PubChem CID 57064419) has the molecular formula C16H12F2N2O2S
and a molecular weight of 334.35 g/mol. Its IUPAC name is 3-(2,4-difluorophenyl)-N-[(1R)-1-thiophen-2-ylethyl]-1,2-oxazole-5-carboxamide.
Molecular Properties
| Compound Name | 3-(2,4-difluorophenyl)-N-[(1R)-1-thiophen-2-ylethyl]-1,2-oxazole-5-carboxamide |
| PubChem CID | 57064419 |
| Molecular Formula | C16H12F2N2O2S |
| Molecular Weight | 334.35 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | 3-(2,4-difluorophenyl)-N-[(1R)-1-thiophen-2-ylethyl]-1,2-oxazole-5-carboxamide |
| SMILES | C[C@@H](NC(=O)c1cc(-c2ccc(F)cc2F)no1)c1cccs1 |
| InChI | InChI=1S/C16H12F2N2O2S/c1-9(15-3-2-6-23-15)19-16(21)14-8-13(20-22-14)11-5-4-10(17)7-12(11)18/h2-9H,1H3,(H,19,21)/t9-/m1/s1 |
| InChIKey | FZLFXJWRYDQDNR-SECBINFHSA-N |
| XLogP | 4.17 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.35 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(2,4-difluorophenyl)-N-[(1R)-1-thiophen-2-ylethyl]-1,2-oxazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,4-difluorophenyl)-N-[(1R)-1-thiophen-2-ylethyl]-1,2-oxazole-5-carboxamide?
The IUPAC name of 3-(2,4-difluorophenyl)-N-[(1R)-1-thiophen-2-ylethyl]-1,2-oxazole-5-carboxamide (CID 57064419) is 3-(2,4-difluorophenyl)-N-[(1R)-1-thiophen-2-ylethyl]-1,2-oxazole-5-carboxamide.
What is the SMILES notation for 3-(2,4-difluorophenyl)-N-[(1R)-1-thiophen-2-ylethyl]-1,2-oxazole-5-carboxamide?
The canonical SMILES for 3-(2,4-difluorophenyl)-N-[(1R)-1-thiophen-2-ylethyl]-1,2-oxazole-5-carboxamide is C[C@@H](NC(=O)c1cc(-c2ccc(F)cc2F)no1)c1cccs1.
What is the InChIKey of 3-(2,4-difluorophenyl)-N-[(1R)-1-thiophen-2-ylethyl]-1,2-oxazole-5-carboxamide?
The InChIKey is FZLFXJWRYDQDNR-SECBINFHSA-N. The full InChI is InChI=1S/C16H12F2N2O2S/c1-9(15-3-2-6-23-15)19-16(21)14-8-13(20-22-14)11-5-4-10(17)7-12(11)18/h2-9H,1H3,(H,19,21)/t9-/m1/s1.
What are the key properties of 3-(2,4-difluorophenyl)-N-[(1R)-1-thiophen-2-ylethyl]-1,2-oxazole-5-carboxamide?
3-(2,4-difluorophenyl)-N-[(1R)-1-thiophen-2-ylethyl]-1,2-oxazole-5-carboxamide has a molecular weight of 334.35 g/mol, XLogP of 4.17, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,4-difluorophenyl)-N-[(1R)-1-thiophen-2-ylethyl]-1,2-oxazole-5-carboxamide is sourced from PubChem (CID 57064419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).