About 2-(13-aminotridecyl)-1,2-thiazol-3-one
2-(13-aminotridecyl)-1,2-thiazol-3-one (PubChem CID 57064737) has the molecular formula C16H30N2OS
and a molecular weight of 298.50 g/mol. Its IUPAC name is 2-(13-aminotridecyl)-1,2-thiazol-3-one.
Molecular Properties
| Compound Name | 2-(13-aminotridecyl)-1,2-thiazol-3-one |
| PubChem CID | 57064737 |
| Molecular Formula | C16H30N2OS |
| Molecular Weight | 298.50 g/mol |
| Exact Mass | 298.21 |
| IUPAC Name | 2-(13-aminotridecyl)-1,2-thiazol-3-one |
| SMILES | NCCCCCCCCCCCCCn1sccc1=O |
| InChI | InChI=1S/C16H30N2OS/c17-13-10-8-6-4-2-1-3-5-7-9-11-14-18-16(19)12-15-20-18/h12,15H,1-11,13-14,17H2 |
| InChIKey | PILKNDBHBTZTJX-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.50 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(13-aminotridecyl)-1,2-thiazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(13-aminotridecyl)-1,2-thiazol-3-one?
The IUPAC name of 2-(13-aminotridecyl)-1,2-thiazol-3-one (CID 57064737) is 2-(13-aminotridecyl)-1,2-thiazol-3-one.
What is the SMILES notation for 2-(13-aminotridecyl)-1,2-thiazol-3-one?
The canonical SMILES for 2-(13-aminotridecyl)-1,2-thiazol-3-one is NCCCCCCCCCCCCCn1sccc1=O.
What is the InChIKey of 2-(13-aminotridecyl)-1,2-thiazol-3-one?
The InChIKey is PILKNDBHBTZTJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H30N2OS/c17-13-10-8-6-4-2-1-3-5-7-9-11-14-18-16(19)12-15-20-18/h12,15H,1-11,13-14,17H2.
What are the key properties of 2-(13-aminotridecyl)-1,2-thiazol-3-one?
2-(13-aminotridecyl)-1,2-thiazol-3-one has a molecular weight of 298.50 g/mol, XLogP of 4.16, 13 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(13-aminotridecyl)-1,2-thiazol-3-one is sourced from PubChem (CID 57064737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).