C37H37F3N2O4S — CID 57065346
3-[(3,5-ditert-butyl-4-phenylmethoxyphenyl)methylidene]-2-oxo-N-[4-(trifluoromethyl)phenyl]-1H-indole-5-sulfonamide (PubChem CID 57065346) has the molecular formula C37H37F3N2O4S and a molecular weight of 662.77 g/mol. Its IUPAC name is 3-[(3,5-ditert-butyl-4-phenylmethoxyphenyl)methylidene]-2-oxo-N-[4-(trifluoromethyl)phenyl]-1H-indole-5-sulfonamide.
| Compound Name | 3-[(3,5-ditert-butyl-4-phenylmethoxyphenyl)methylidene]-2-oxo-N-[4-(trifluoromethyl)phenyl]-1H-indole-5-sulfonamide |
|---|---|
| PubChem CID | 57065346 |
| Molecular Formula | C37H37F3N2O4S |
| Molecular Weight | 662.77 g/mol |
| Exact Mass | 662.24 |
| IUPAC Name | 3-[(3,5-ditert-butyl-4-phenylmethoxyphenyl)methylidene]-2-oxo-N-[4-(trifluoromethyl)phenyl]-1H-indole-5-sulfonamide |
| SMILES | CC(C)(C)c1cc(C=C2C(=O)Nc3ccc(S(=O)(=O)Nc4ccc(C(F)(F)F)cc4)cc32)cc(C(C)(C)C)c1OCc1ccccc1 |
| InChI | InChI=1S/C37H37F3N2O4S/c1-35(2,3)30-19-24(20-31(36(4,5)6)33(30)46-22-23-10-8-7-9-11-23)18-29-28-21-27(16-17-32(28)41-34(29)43)47(44,45)42-26-14-12-25(13-15-26)37(38,39)40/h7-21,42H,22H2,1-6H3,(H,41,43) |
| InChIKey | JYPKKYKDUBJEJE-UHFFFAOYSA-N |
| XLogP | 9.17 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.77 |
| LogP ≤ 5 | 9.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|