C22H28O3 — CID 57065400
(8R,9R,10S,13S,14S)-10,13-dimethyl-7-prop-2-ynyl-1,2,4,5,6,7,8,9,11,12,14,15-dodecahydrocyclopenta[a]phenanthrene-3,16,17-trione (PubChem CID 57065400) has the molecular formula C22H28O3 and a molecular weight of 340.46 g/mol. Its IUPAC name is (8R,9R,10S,13S,14S)-10,13-dimethyl-7-prop-2-ynyl-1,2,4,5,6,7,8,9,11,12,14,15-dodecahydrocyclopenta[a]phenanthrene-3,16,17-trione.
| Compound Name | (8R,9R,10S,13S,14S)-10,13-dimethyl-7-prop-2-ynyl-1,2,4,5,6,7,8,9,11,12,14,15-dodecahydrocyclopenta[a]phenanthrene-3,16,17-trione |
|---|---|
| PubChem CID | 57065400 |
| Molecular Formula | C22H28O3 |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | (8R,9R,10S,13S,14S)-10,13-dimethyl-7-prop-2-ynyl-1,2,4,5,6,7,8,9,11,12,14,15-dodecahydrocyclopenta[a]phenanthrene-3,16,17-trione |
| SMILES | C#CCC1CC2CC(=O)CC[C@]2(C)[C@@H]2CC[C@]3(C)C(=O)C(=O)C[C@H]3[C@H]12 |
| InChI | InChI=1S/C22H28O3/c1-4-5-13-10-14-11-15(23)6-8-21(14,2)16-7-9-22(3)17(19(13)16)12-18(24)20(22)25/h1,13-14,16-17,19H,5-12H2,2-3H3/t13?,14?,16-,17+,19-,21+,22+/m1/s1 |
| InChIKey | LBEDMUZOYQASCO-WOIPMZMESA-N |
| XLogP | 3.60 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|