C11H16O3 — CID 57065541
(1'R,3'aR,6'aS)-spiro[1,3-dioxolane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-1'-carbaldehyde (PubChem CID 57065541) has the molecular formula C11H16O3 and a molecular weight of 196.25 g/mol. Its IUPAC name is (1'R,3'aR,6'aS)-spiro[1,3-dioxolane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-1'-carbaldehyde.
| Compound Name | (1'R,3'aR,6'aS)-spiro[1,3-dioxolane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-1'-carbaldehyde |
|---|---|
| PubChem CID | 57065541 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | (1'R,3'aR,6'aS)-spiro[1,3-dioxolane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-1'-carbaldehyde |
| SMILES | O=C[C@@H]1CC[C@@H]2CC3(C[C@@H]21)OCCO3 |
| InChI | InChI=1S/C11H16O3/c12-7-9-2-1-8-5-11(6-10(8)9)13-3-4-14-11/h7-10H,1-6H2/t8-,9+,10+/m1/s1 |
| InChIKey | YENHDUKOGSVXIU-UTLUCORTSA-N |
| XLogP | 1.36 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|