About ethyl 3-cyanoimino-2,4-dimethylpentanoate
ethyl 3-cyanoimino-2,4-dimethylpentanoate (PubChem CID 57066416) has the molecular formula C10H16N2O2
and a molecular weight of 196.25 g/mol. Its IUPAC name is ethyl 3-cyanoimino-2,4-dimethylpentanoate.
Molecular Properties
| Compound Name | ethyl 3-cyanoimino-2,4-dimethylpentanoate |
| PubChem CID | 57066416 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | ethyl 3-cyanoimino-2,4-dimethylpentanoate |
| SMILES | CCOC(=O)C(C)/C(=N/C#N)C(C)C |
| InChI | InChI=1S/C10H16N2O2/c1-5-14-10(13)8(4)9(7(2)3)12-6-11/h7-8H,5H2,1-4H3/b12-9+ |
| InChIKey | WKWUGAZNPSVUEH-FMIVXFBMSA-N |
| XLogP | 1.76 |
| TPSA | 62.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-cyanoimino-2,4-dimethylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-cyanoimino-2,4-dimethylpentanoate?
The IUPAC name of ethyl 3-cyanoimino-2,4-dimethylpentanoate (CID 57066416) is ethyl 3-cyanoimino-2,4-dimethylpentanoate.
What is the SMILES notation for ethyl 3-cyanoimino-2,4-dimethylpentanoate?
The canonical SMILES for ethyl 3-cyanoimino-2,4-dimethylpentanoate is CCOC(=O)C(C)/C(=N/C#N)C(C)C.
What is the InChIKey of ethyl 3-cyanoimino-2,4-dimethylpentanoate?
The InChIKey is WKWUGAZNPSVUEH-FMIVXFBMSA-N. The full InChI is InChI=1S/C10H16N2O2/c1-5-14-10(13)8(4)9(7(2)3)12-6-11/h7-8H,5H2,1-4H3/b12-9+.
What are the key properties of ethyl 3-cyanoimino-2,4-dimethylpentanoate?
ethyl 3-cyanoimino-2,4-dimethylpentanoate has a molecular weight of 196.25 g/mol, XLogP of 1.76, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-cyanoimino-2,4-dimethylpentanoate is sourced from PubChem (CID 57066416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).