About 4-(3-phenyl-2,5-dihydro-1,2-oxazol-4-yl)morpholine
4-(3-phenyl-2,5-dihydro-1,2-oxazol-4-yl)morpholine (PubChem CID 57066823) has the molecular formula C13H16N2O2
and a molecular weight of 232.28 g/mol. Its IUPAC name is 4-(3-phenyl-2,5-dihydro-1,2-oxazol-4-yl)morpholine.
Molecular Properties
| Compound Name | 4-(3-phenyl-2,5-dihydro-1,2-oxazol-4-yl)morpholine |
| PubChem CID | 57066823 |
| Molecular Formula | C13H16N2O2 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | 4-(3-phenyl-2,5-dihydro-1,2-oxazol-4-yl)morpholine |
| SMILES | c1ccc(C2=C(N3CCOCC3)CON2)cc1 |
| InChI | InChI=1S/C13H16N2O2/c1-2-4-11(5-3-1)13-12(10-17-14-13)15-6-8-16-9-7-15/h1-5,14H,6-10H2 |
| InChIKey | SAWWQLVOKBLABE-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(3-phenyl-2,5-dihydro-1,2-oxazol-4-yl)morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-phenyl-2,5-dihydro-1,2-oxazol-4-yl)morpholine?
The IUPAC name of 4-(3-phenyl-2,5-dihydro-1,2-oxazol-4-yl)morpholine (CID 57066823) is 4-(3-phenyl-2,5-dihydro-1,2-oxazol-4-yl)morpholine.
What is the SMILES notation for 4-(3-phenyl-2,5-dihydro-1,2-oxazol-4-yl)morpholine?
The canonical SMILES for 4-(3-phenyl-2,5-dihydro-1,2-oxazol-4-yl)morpholine is c1ccc(C2=C(N3CCOCC3)CON2)cc1.
What is the InChIKey of 4-(3-phenyl-2,5-dihydro-1,2-oxazol-4-yl)morpholine?
The InChIKey is SAWWQLVOKBLABE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2O2/c1-2-4-11(5-3-1)13-12(10-17-14-13)15-6-8-16-9-7-15/h1-5,14H,6-10H2.
What are the key properties of 4-(3-phenyl-2,5-dihydro-1,2-oxazol-4-yl)morpholine?
4-(3-phenyl-2,5-dihydro-1,2-oxazol-4-yl)morpholine has a molecular weight of 232.28 g/mol, XLogP of 1.22, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-phenyl-2,5-dihydro-1,2-oxazol-4-yl)morpholine is sourced from PubChem (CID 57066823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).