C23H45NO2 — CID 57067141
N-(1-hydroxypropyl)-3,7,11,15-tetramethylhexadec-2-enamide (PubChem CID 57067141) has the molecular formula C23H45NO2 and a molecular weight of 367.62 g/mol. Its IUPAC name is N-(1-hydroxypropyl)-3,7,11,15-tetramethylhexadec-2-enamide.
| Compound Name | N-(1-hydroxypropyl)-3,7,11,15-tetramethylhexadec-2-enamide |
|---|---|
| PubChem CID | 57067141 |
| Molecular Formula | C23H45NO2 |
| Molecular Weight | 367.62 g/mol |
| Exact Mass | 367.35 |
| IUPAC Name | N-(1-hydroxypropyl)-3,7,11,15-tetramethylhexadec-2-enamide |
| SMILES | CCC(O)NC(=O)C=C(C)CCCC(C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C23H45NO2/c1-7-22(25)24-23(26)17-21(6)16-10-15-20(5)14-9-13-19(4)12-8-11-18(2)3/h17-20,22,25H,7-16H2,1-6H3,(H,24,26) |
| InChIKey | LQIJHZVEHTUZCS-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.62 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|