About 2-oxopropyl hex-4-enoate
2-oxopropyl hex-4-enoate (PubChem CID 57067250) has the molecular formula C9H14O3
and a molecular weight of 170.21 g/mol. Its IUPAC name is 2-oxopropyl hex-4-enoate.
Molecular Properties
| Compound Name | 2-oxopropyl hex-4-enoate |
| PubChem CID | 57067250 |
| Molecular Formula | C9H14O3 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | 2-oxopropyl hex-4-enoate |
| SMILES | CC=CCCC(=O)OCC(C)=O |
| InChI | InChI=1S/C9H14O3/c1-3-4-5-6-9(11)12-7-8(2)10/h3-4H,5-7H2,1-2H3 |
| InChIKey | JXXGQOXXYLAXAA-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-oxopropyl hex-4-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxopropyl hex-4-enoate?
The IUPAC name of 2-oxopropyl hex-4-enoate (CID 57067250) is 2-oxopropyl hex-4-enoate.
What is the SMILES notation for 2-oxopropyl hex-4-enoate?
The canonical SMILES for 2-oxopropyl hex-4-enoate is CC=CCCC(=O)OCC(C)=O.
What is the InChIKey of 2-oxopropyl hex-4-enoate?
The InChIKey is JXXGQOXXYLAXAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O3/c1-3-4-5-6-9(11)12-7-8(2)10/h3-4H,5-7H2,1-2H3.
What are the key properties of 2-oxopropyl hex-4-enoate?
2-oxopropyl hex-4-enoate has a molecular weight of 170.21 g/mol, XLogP of 1.47, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxopropyl hex-4-enoate is sourced from PubChem (CID 57067250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).