About [4-[(4-benzyl-2-oxo-1,3-oxazolidin-5-yl)oxysulfonyl]phenyl]-methoxy-oxoazanium
[4-[(4-benzyl-2-oxo-1,3-oxazolidin-5-yl)oxysulfonyl]phenyl]-methoxy-oxoazanium (PubChem CID 57067258) has the molecular formula C17H17N2O7S+
and a molecular weight of 393.40 g/mol. Its IUPAC name is [4-[(4-benzyl-2-oxo-1,3-oxazolidin-5-yl)oxysulfonyl]phenyl]-methoxy-oxoazanium.
Molecular Properties
| Compound Name | [4-[(4-benzyl-2-oxo-1,3-oxazolidin-5-yl)oxysulfonyl]phenyl]-methoxy-oxoazanium |
| PubChem CID | 57067258 |
| Molecular Formula | C17H17N2O7S+ |
| Molecular Weight | 393.40 g/mol |
| Exact Mass | 393.08 |
| IUPAC Name | [4-[(4-benzyl-2-oxo-1,3-oxazolidin-5-yl)oxysulfonyl]phenyl]-methoxy-oxoazanium |
| SMILES | CO[N+](=O)c1ccc(S(=O)(=O)OC2OC(=O)NC2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C17H16N2O7S/c1-24-19(21)13-7-9-14(10-8-13)27(22,23)26-16-15(18-17(20)25-16)11-12-5-3-2-4-6-12/h2-10,15-16H,11H2,1H3/p+1 |
| InChIKey | UGXCMJUONHQRPB-UHFFFAOYSA-O |
| XLogP | 2.04 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.40 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [4-[(4-benzyl-2-oxo-1,3-oxazolidin-5-yl)oxysulfonyl]phenyl]-methoxy-oxoazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(4-benzyl-2-oxo-1,3-oxazolidin-5-yl)oxysulfonyl]phenyl]-methoxy-oxoazanium?
The IUPAC name of [4-[(4-benzyl-2-oxo-1,3-oxazolidin-5-yl)oxysulfonyl]phenyl]-methoxy-oxoazanium (CID 57067258) is [4-[(4-benzyl-2-oxo-1,3-oxazolidin-5-yl)oxysulfonyl]phenyl]-methoxy-oxoazanium.
What is the SMILES notation for [4-[(4-benzyl-2-oxo-1,3-oxazolidin-5-yl)oxysulfonyl]phenyl]-methoxy-oxoazanium?
The canonical SMILES for [4-[(4-benzyl-2-oxo-1,3-oxazolidin-5-yl)oxysulfonyl]phenyl]-methoxy-oxoazanium is CO[N+](=O)c1ccc(S(=O)(=O)OC2OC(=O)NC2Cc2ccccc2)cc1.
What is the InChIKey of [4-[(4-benzyl-2-oxo-1,3-oxazolidin-5-yl)oxysulfonyl]phenyl]-methoxy-oxoazanium?
The InChIKey is UGXCMJUONHQRPB-UHFFFAOYSA-O. The full InChI is InChI=1S/C17H16N2O7S/c1-24-19(21)13-7-9-14(10-8-13)27(22,23)26-16-15(18-17(20)25-16)11-12-5-3-2-4-6-12/h2-10,15-16H,11H2,1H3/p+1.
What are the key properties of [4-[(4-benzyl-2-oxo-1,3-oxazolidin-5-yl)oxysulfonyl]phenyl]-methoxy-oxoazanium?
[4-[(4-benzyl-2-oxo-1,3-oxazolidin-5-yl)oxysulfonyl]phenyl]-methoxy-oxoazanium has a molecular weight of 393.40 g/mol, XLogP of 2.04, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(4-benzyl-2-oxo-1,3-oxazolidin-5-yl)oxysulfonyl]phenyl]-methoxy-oxoazanium is sourced from PubChem (CID 57067258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).