C20H24BN2O4 — CID 57067406
CID 57067406 (PubChem CID 57067406) has the molecular formula C20H24BN2O4 and a molecular weight of 367.23 g/mol.
| Compound Name | CID 57067406 |
|---|---|
| PubChem CID | 57067406 |
| Molecular Formula | C20H24BN2O4 |
| Molecular Weight | 367.23 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | — |
| SMILES | CC(=O)NC(CO[B]OCC(NC(C)=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H24BN2O4/c1-15(24)22-19(17-9-5-3-6-10-17)13-26-21-27-14-20(23-16(2)25)18-11-7-4-8-12-18/h3-12,19-20H,13-14H2,1-2H3,(H,22,24)(H,23,25) |
| InChIKey | NHGLMAQACWHCSG-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.23 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|