About N-tert-butyl-1,1-dioxothiazinane-3-sulfonamide
N-tert-butyl-1,1-dioxothiazinane-3-sulfonamide (PubChem CID 57067965) has the molecular formula C8H18N2O4S2
and a molecular weight of 270.38 g/mol. Its IUPAC name is N-tert-butyl-1,1-dioxothiazinane-3-sulfonamide.
Molecular Properties
| Compound Name | N-tert-butyl-1,1-dioxothiazinane-3-sulfonamide |
| PubChem CID | 57067965 |
| Molecular Formula | C8H18N2O4S2 |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | N-tert-butyl-1,1-dioxothiazinane-3-sulfonamide |
| SMILES | CC(C)(C)NS(=O)(=O)C1CCCS(=O)(=O)N1 |
| InChI | InChI=1S/C8H18N2O4S2/c1-8(2,3)10-16(13,14)7-5-4-6-15(11,12)9-7/h7,9-10H,4-6H2,1-3H3 |
| InChIKey | OUMKROVBIPYPQA-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-tert-butyl-1,1-dioxothiazinane-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-1,1-dioxothiazinane-3-sulfonamide?
The IUPAC name of N-tert-butyl-1,1-dioxothiazinane-3-sulfonamide (CID 57067965) is N-tert-butyl-1,1-dioxothiazinane-3-sulfonamide.
What is the SMILES notation for N-tert-butyl-1,1-dioxothiazinane-3-sulfonamide?
The canonical SMILES for N-tert-butyl-1,1-dioxothiazinane-3-sulfonamide is CC(C)(C)NS(=O)(=O)C1CCCS(=O)(=O)N1.
What is the InChIKey of N-tert-butyl-1,1-dioxothiazinane-3-sulfonamide?
The InChIKey is OUMKROVBIPYPQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N2O4S2/c1-8(2,3)10-16(13,14)7-5-4-6-15(11,12)9-7/h7,9-10H,4-6H2,1-3H3.
What are the key properties of N-tert-butyl-1,1-dioxothiazinane-3-sulfonamide?
N-tert-butyl-1,1-dioxothiazinane-3-sulfonamide has a molecular weight of 270.38 g/mol, XLogP of -0.26, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-1,1-dioxothiazinane-3-sulfonamide is sourced from PubChem (CID 57067965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).