C31H37NO9 — CID 57068223
10-butyl-23-(dimethylamino)-4,8,12,22,24-pentahydroxy-1,12-dimethyl-20,25-dioxahexacyclo[19.3.1.02,19.05,18.07,16.09,14]pentacosa-2,4,7(16),8,14,18-hexaene-6,17-dione (PubChem CID 57068223) has the molecular formula C31H37NO9 and a molecular weight of 567.64 g/mol. Its IUPAC name is 10-butyl-23-(dimethylamino)-4,8,12,22,24-pentahydroxy-1,12-dimethyl-20,25-dioxahexacyclo[19.3.1.02,19.05,18.07,16.09,14]pentacosa-2,4,7(16),8,14,18-hexaene-6,17-dione.
| Compound Name | 10-butyl-23-(dimethylamino)-4,8,12,22,24-pentahydroxy-1,12-dimethyl-20,25-dioxahexacyclo[19.3.1.02,19.05,18.07,16.09,14]pentacosa-2,4,7(16),8,14,18-hexaene-6,17-dione |
|---|---|
| PubChem CID | 57068223 |
| Molecular Formula | C31H37NO9 |
| Molecular Weight | 567.64 g/mol |
| Exact Mass | 567.25 |
| IUPAC Name | 10-butyl-23-(dimethylamino)-4,8,12,22,24-pentahydroxy-1,12-dimethyl-20,25-dioxahexacyclo[19.3.1.02,19.05,18.07,16.09,14]pentacosa-2,4,7(16),8,14,18-hexaene-6,17-dione |
| SMILES | CCCCC1CC(C)(O)Cc2cc3c(c(O)c21)C(=O)c1c(O)cc2c(c1C3=O)OC1OC2(C)C(O)C(N(C)C)C1O |
| InChI | InChI=1S/C31H37NO9/c1-6-7-8-13-11-30(2,39)12-14-9-15-19(24(35)18(13)14)25(36)20-17(33)10-16-27(21(20)23(15)34)40-29-26(37)22(32(4)5)28(38)31(16,3)41-29/h9-10,13,22,26,28-29,33,35,37-39H,6-8,11-12H2,1-5H3 |
| InChIKey | JDYBSPZCKUNJMH-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 156.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.64 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|