C11H8F4O3 — CID 57068240
(1S,2S)-5,6,7,8-tetrafluoro-1-hydroxy-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid (PubChem CID 57068240) has the molecular formula C11H8F4O3 and a molecular weight of 264.17 g/mol. Its IUPAC name is (1S,2S)-5,6,7,8-tetrafluoro-1-hydroxy-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid.
| Compound Name | (1S,2S)-5,6,7,8-tetrafluoro-1-hydroxy-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 57068240 |
| Molecular Formula | C11H8F4O3 |
| Molecular Weight | 264.17 g/mol |
| Exact Mass | 264.04 |
| IUPAC Name | (1S,2S)-5,6,7,8-tetrafluoro-1-hydroxy-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid |
| SMILES | O=C(O)[C@H]1CCc2c(F)c(F)c(F)c(F)c2[C@H]1O |
| InChI | InChI=1S/C11H8F4O3/c12-6-3-1-2-4(11(17)18)10(16)5(3)7(13)9(15)8(6)14/h4,10,16H,1-2H2,(H,17,18)/t4-,10-/m0/s1 |
| InChIKey | UTFUHVLSMWXITA-MFXDVPHUSA-N |
| XLogP | 1.92 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.17 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|