About 3-azabicyclo[6.2.2]dodeca-2,7,9-triene
3-azabicyclo[6.2.2]dodeca-2,7,9-triene (PubChem CID 57068287) has the molecular formula C11H15N
and a molecular weight of 161.25 g/mol. Its IUPAC name is 3-azabicyclo[6.2.2]dodeca-2,7,9-triene.
Molecular Properties
| Compound Name | 3-azabicyclo[6.2.2]dodeca-2,7,9-triene |
| PubChem CID | 57068287 |
| Molecular Formula | C11H15N |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | 3-azabicyclo[6.2.2]dodeca-2,7,9-triene |
| SMILES | C1=CC2/C=N\CCCC=C1CC2 |
| InChI | InChI=1S/C11H15N/c1-2-8-12-9-11-6-4-10(3-1)5-7-11/h3-4,6,9,11H,1-2,5,7-8H2/b10-3?,12-9- |
| InChIKey | MIBONGVAWDKNOB-BXWAFVKRSA-N |
| XLogP | 2.74 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-azabicyclo[6.2.2]dodeca-2,7,9-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-azabicyclo[6.2.2]dodeca-2,7,9-triene?
The IUPAC name of 3-azabicyclo[6.2.2]dodeca-2,7,9-triene (CID 57068287) is 3-azabicyclo[6.2.2]dodeca-2,7,9-triene.
What is the SMILES notation for 3-azabicyclo[6.2.2]dodeca-2,7,9-triene?
The canonical SMILES for 3-azabicyclo[6.2.2]dodeca-2,7,9-triene is C1=CC2/C=N\CCCC=C1CC2.
What is the InChIKey of 3-azabicyclo[6.2.2]dodeca-2,7,9-triene?
The InChIKey is MIBONGVAWDKNOB-BXWAFVKRSA-N. The full InChI is InChI=1S/C11H15N/c1-2-8-12-9-11-6-4-10(3-1)5-7-11/h3-4,6,9,11H,1-2,5,7-8H2/b10-3?,12-9-.
What are the key properties of 3-azabicyclo[6.2.2]dodeca-2,7,9-triene?
3-azabicyclo[6.2.2]dodeca-2,7,9-triene has a molecular weight of 161.25 g/mol, XLogP of 2.74, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-azabicyclo[6.2.2]dodeca-2,7,9-triene is sourced from PubChem (CID 57068287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).