C12H18 — CID 570683
6,7-dimethyl-1,2,3,5,8,8a-hexahydronaphthalene (PubChem CID 570683) has the molecular formula C12H18 and a molecular weight of 162.28 g/mol. Its IUPAC name is 6,7-dimethyl-1,2,3,5,8,8a-hexahydronaphthalene.
| Compound Name | 6,7-dimethyl-1,2,3,5,8,8a-hexahydronaphthalene |
|---|---|
| PubChem CID | 570683 |
| Molecular Formula | C12H18 |
| Molecular Weight | 162.28 g/mol |
| Exact Mass | 162.14 |
| IUPAC Name | 6,7-dimethyl-1,2,3,5,8,8a-hexahydronaphthalene |
| SMILES | CC1=C(C)CC2CCCC=C2C1 |
| InChI | InChI=1S/C12H18/c1-9-7-11-5-3-4-6-12(11)8-10(9)2/h5,12H,3-4,6-8H2,1-2H3 |
| InChIKey | JYPYONFSJRKPQY-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.28 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|