C16H15N — CID 57069115
15-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),3,5,9,11,13-hexaene (PubChem CID 57069115) has the molecular formula C16H15N and a molecular weight of 221.30 g/mol. Its IUPAC name is 15-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),3,5,9,11,13-hexaene.
| Compound Name | 15-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),3,5,9,11,13-hexaene |
|---|---|
| PubChem CID | 57069115 |
| Molecular Formula | C16H15N |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 15-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),3,5,9,11,13-hexaene |
| SMILES | C1=CC2Cc3cccc4c3=C(CNC=4)C2C=C1 |
| InChI | InChI=1S/C16H15N/c1-2-7-14-11(4-1)8-12-5-3-6-13-9-17-10-15(14)16(12)13/h1-7,9,11,14,17H,8,10H2 |
| InChIKey | HGSVEDVQFOHDFV-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |