About [7-(dimethylamino)-1-ethyl-4-oxo-[1,3]dioxolo[4,5-g]cinnolin-3-yl] carbonochloridate
[7-(dimethylamino)-1-ethyl-4-oxo-[1,3]dioxolo[4,5-g]cinnolin-3-yl] carbonochloridate (PubChem CID 57069309) has the molecular formula C14H14ClN3O5
and a molecular weight of 339.74 g/mol. Its IUPAC name is [7-(dimethylamino)-1-ethyl-4-oxo-[1,3]dioxolo[4,5-g]cinnolin-3-yl] carbonochloridate.
Molecular Properties
| Compound Name | [7-(dimethylamino)-1-ethyl-4-oxo-[1,3]dioxolo[4,5-g]cinnolin-3-yl] carbonochloridate |
| PubChem CID | 57069309 |
| Molecular Formula | C14H14ClN3O5 |
| Molecular Weight | 339.74 g/mol |
| Exact Mass | 339.06 |
| IUPAC Name | [7-(dimethylamino)-1-ethyl-4-oxo-[1,3]dioxolo[4,5-g]cinnolin-3-yl] carbonochloridate |
| SMILES | CCn1nc(OC(=O)Cl)c(=O)c2cc3c(cc21)OC(N(C)C)O3 |
| InChI | InChI=1S/C14H14ClN3O5/c1-4-18-8-6-10-9(21-14(22-10)17(2)3)5-7(8)11(19)12(16-18)23-13(15)20/h5-6,14H,4H2,1-3H3 |
| InChIKey | JUWZUTRMJOPNBO-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 82.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.74 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze [7-(dimethylamino)-1-ethyl-4-oxo-[1,3]dioxolo[4,5-g]cinnolin-3-yl] carbonochloridate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [7-(dimethylamino)-1-ethyl-4-oxo-[1,3]dioxolo[4,5-g]cinnolin-3-yl] carbonochloridate?
The IUPAC name of [7-(dimethylamino)-1-ethyl-4-oxo-[1,3]dioxolo[4,5-g]cinnolin-3-yl] carbonochloridate (CID 57069309) is [7-(dimethylamino)-1-ethyl-4-oxo-[1,3]dioxolo[4,5-g]cinnolin-3-yl] carbonochloridate.
What is the SMILES notation for [7-(dimethylamino)-1-ethyl-4-oxo-[1,3]dioxolo[4,5-g]cinnolin-3-yl] carbonochloridate?
The canonical SMILES for [7-(dimethylamino)-1-ethyl-4-oxo-[1,3]dioxolo[4,5-g]cinnolin-3-yl] carbonochloridate is CCn1nc(OC(=O)Cl)c(=O)c2cc3c(cc21)OC(N(C)C)O3.
What is the InChIKey of [7-(dimethylamino)-1-ethyl-4-oxo-[1,3]dioxolo[4,5-g]cinnolin-3-yl] carbonochloridate?
The InChIKey is JUWZUTRMJOPNBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14ClN3O5/c1-4-18-8-6-10-9(21-14(22-10)17(2)3)5-7(8)11(19)12(16-18)23-13(15)20/h5-6,14H,4H2,1-3H3.
What are the key properties of [7-(dimethylamino)-1-ethyl-4-oxo-[1,3]dioxolo[4,5-g]cinnolin-3-yl] carbonochloridate?
[7-(dimethylamino)-1-ethyl-4-oxo-[1,3]dioxolo[4,5-g]cinnolin-3-yl] carbonochloridate has a molecular weight of 339.74 g/mol, XLogP of 1.77, 3 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [7-(dimethylamino)-1-ethyl-4-oxo-[1,3]dioxolo[4,5-g]cinnolin-3-yl] carbonochloridate is sourced from PubChem (CID 57069309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).