C8H18N4O6 — CID 57069467
1,4-bis[(2-aminoethylamino)oxy]-1,4-dihydroxybutane-2,3-dione (PubChem CID 57069467) has the molecular formula C8H18N4O6 and a molecular weight of 266.25 g/mol. Its IUPAC name is 1,4-bis[(2-aminoethylamino)oxy]-1,4-dihydroxybutane-2,3-dione.
| Compound Name | 1,4-bis[(2-aminoethylamino)oxy]-1,4-dihydroxybutane-2,3-dione |
|---|---|
| PubChem CID | 57069467 |
| Molecular Formula | C8H18N4O6 |
| Molecular Weight | 266.25 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | 1,4-bis[(2-aminoethylamino)oxy]-1,4-dihydroxybutane-2,3-dione |
| SMILES | NCCNOC(O)C(=O)C(=O)C(O)ONCCN |
| InChI | InChI=1S/C8H18N4O6/c9-1-3-11-17-7(15)5(13)6(14)8(16)18-12-4-2-10/h7-8,11-12,15-16H,1-4,9-10H2 |
| InChIKey | YQHCIZBAGFJLMU-UHFFFAOYSA-N |
| XLogP | -4.28 |
| TPSA | 169.16 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.25 |
| LogP ≤ 5 | -4.28 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|