C26H37N3O4 — CID 57069575
N-[4-(2-acetylhydrazinyl)phenyl]-2-(2,4-ditert-butylphenoxy)-N-hydroxybutanamide (PubChem CID 57069575) has the molecular formula C26H37N3O4 and a molecular weight of 455.60 g/mol. Its IUPAC name is N-[4-(2-acetylhydrazinyl)phenyl]-2-(2,4-ditert-butylphenoxy)-N-hydroxybutanamide.
| Compound Name | N-[4-(2-acetylhydrazinyl)phenyl]-2-(2,4-ditert-butylphenoxy)-N-hydroxybutanamide |
|---|---|
| PubChem CID | 57069575 |
| Molecular Formula | C26H37N3O4 |
| Molecular Weight | 455.60 g/mol |
| Exact Mass | 455.28 |
| IUPAC Name | N-[4-(2-acetylhydrazinyl)phenyl]-2-(2,4-ditert-butylphenoxy)-N-hydroxybutanamide |
| SMILES | CCC(Oc1ccc(C(C)(C)C)cc1C(C)(C)C)C(=O)N(O)c1ccc(NNC(C)=O)cc1 |
| InChI | InChI=1S/C26H37N3O4/c1-9-22(24(31)29(32)20-13-11-19(12-14-20)28-27-17(2)30)33-23-15-10-18(25(3,4)5)16-21(23)26(6,7)8/h10-16,22,28,32H,9H2,1-8H3,(H,27,30) |
| InChIKey | MXMDKSIUIFEBDA-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.60 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|