C18H17FN2O2 — CID 57069952
[1-benzyl-4-(3-fluoro-4-methoxyphenyl)pyrazol-5-yl]methanol (PubChem CID 57069952) has the molecular formula C18H17FN2O2 and a molecular weight of 312.34 g/mol. Its IUPAC name is [1-benzyl-4-(3-fluoro-4-methoxyphenyl)pyrazol-5-yl]methanol.
| Compound Name | [1-benzyl-4-(3-fluoro-4-methoxyphenyl)pyrazol-5-yl]methanol |
|---|---|
| PubChem CID | 57069952 |
| Molecular Formula | C18H17FN2O2 |
| Molecular Weight | 312.34 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | [1-benzyl-4-(3-fluoro-4-methoxyphenyl)pyrazol-5-yl]methanol |
| SMILES | COc1ccc(-c2cnn(Cc3ccccc3)c2CO)cc1F |
| InChI | InChI=1S/C18H17FN2O2/c1-23-18-8-7-14(9-16(18)19)15-10-20-21(17(15)12-22)11-13-5-3-2-4-6-13/h2-10,22H,11-12H2,1H3 |
| InChIKey | PPVRPNOXIPMOPU-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.34 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |