About bis[3-[(2-amino-2-methylpropanoyl)amino]-2,2-dimethylpropyl] oxalate
bis[3-[(2-amino-2-methylpropanoyl)amino]-2,2-dimethylpropyl] oxalate (PubChem CID 57069971) has the molecular formula C20H38N4O6
and a molecular weight of 430.55 g/mol. Its IUPAC name is bis[3-[(2-amino-2-methylpropanoyl)amino]-2,2-dimethylpropyl] oxalate.
Molecular Properties
| Compound Name | bis[3-[(2-amino-2-methylpropanoyl)amino]-2,2-dimethylpropyl] oxalate |
| PubChem CID | 57069971 |
| Molecular Formula | C20H38N4O6 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.28 |
| IUPAC Name | bis[3-[(2-amino-2-methylpropanoyl)amino]-2,2-dimethylpropyl] oxalate |
| SMILES | CC(C)(CNC(=O)C(C)(C)N)COC(=O)C(=O)OCC(C)(C)CNC(=O)C(C)(C)N |
| InChI | InChI=1S/C20H38N4O6/c1-17(2,9-23-15(27)19(5,6)21)11-29-13(25)14(26)30-12-18(3,4)10-24-16(28)20(7,8)22/h9-12,21-22H2,1-8H3,(H,23,27)(H,24,28) |
| InChIKey | FMOZPXINMLEYJF-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 162.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze bis[3-[(2-amino-2-methylpropanoyl)amino]-2,2-dimethylpropyl] oxalate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[3-[(2-amino-2-methylpropanoyl)amino]-2,2-dimethylpropyl] oxalate?
The IUPAC name of bis[3-[(2-amino-2-methylpropanoyl)amino]-2,2-dimethylpropyl] oxalate (CID 57069971) is bis[3-[(2-amino-2-methylpropanoyl)amino]-2,2-dimethylpropyl] oxalate.
What is the SMILES notation for bis[3-[(2-amino-2-methylpropanoyl)amino]-2,2-dimethylpropyl] oxalate?
The canonical SMILES for bis[3-[(2-amino-2-methylpropanoyl)amino]-2,2-dimethylpropyl] oxalate is CC(C)(CNC(=O)C(C)(C)N)COC(=O)C(=O)OCC(C)(C)CNC(=O)C(C)(C)N.
What is the InChIKey of bis[3-[(2-amino-2-methylpropanoyl)amino]-2,2-dimethylpropyl] oxalate?
The InChIKey is FMOZPXINMLEYJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H38N4O6/c1-17(2,9-23-15(27)19(5,6)21)11-29-13(25)14(26)30-12-18(3,4)10-24-16(28)20(7,8)22/h9-12,21-22H2,1-8H3,(H,23,27)(H,24,28).
What are the key properties of bis[3-[(2-amino-2-methylpropanoyl)amino]-2,2-dimethylpropyl] oxalate?
bis[3-[(2-amino-2-methylpropanoyl)amino]-2,2-dimethylpropyl] oxalate has a molecular weight of 430.55 g/mol, XLogP of -0.17, 10 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for bis[3-[(2-amino-2-methylpropanoyl)amino]-2,2-dimethylpropyl] oxalate is sourced from PubChem (CID 57069971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).