C36H70O2Si2 — CID 57070018
tert-butyl-[7-[3-[[1-(7-cyclopent-2-en-1-ylheptan-3-yloxy)-2-methylpropan-2-yl]-dimethylsilyl]cyclopent-2-en-1-yl]heptan-3-yloxy]-dimethylsilane (PubChem CID 57070018) has the molecular formula C36H70O2Si2 and a molecular weight of 591.13 g/mol. Its IUPAC name is tert-butyl-[7-[3-[[1-(7-cyclopent-2-en-1-ylheptan-3-yloxy)-2-methylpropan-2-yl]-dimethylsilyl]cyclopent-2-en-1-yl]heptan-3-yloxy]-dimethylsilane.
| Compound Name | tert-butyl-[7-[3-[[1-(7-cyclopent-2-en-1-ylheptan-3-yloxy)-2-methylpropan-2-yl]-dimethylsilyl]cyclopent-2-en-1-yl]heptan-3-yloxy]-dimethylsilane |
|---|---|
| PubChem CID | 57070018 |
| Molecular Formula | C36H70O2Si2 |
| Molecular Weight | 591.13 g/mol |
| Exact Mass | 590.49 |
| IUPAC Name | tert-butyl-[7-[3-[[1-(7-cyclopent-2-en-1-ylheptan-3-yloxy)-2-methylpropan-2-yl]-dimethylsilyl]cyclopent-2-en-1-yl]heptan-3-yloxy]-dimethylsilane |
| SMILES | CCC(CCCCC1C=CCC1)OCC(C)(C)[Si](C)(C)C1=CC(CCCCC(CC)O[Si](C)(C)C(C)(C)C)CC1 |
| InChI | InChI=1S/C36H70O2Si2/c1-12-32(24-18-16-22-30-20-14-15-21-30)37-29-36(6,7)39(8,9)34-27-26-31(28-34)23-17-19-25-33(13-2)38-40(10,11)35(3,4)5/h14,20,28,30-33H,12-13,15-19,21-27,29H2,1-11H3 |
| InChIKey | BKEZMZDTCJCEDT-UHFFFAOYSA-N |
| XLogP | 12.03 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.13 |
| LogP ≤ 5 | 12.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|