About (2-hydroxycyclohexyl) 2,4,4-trimethylpent-2-enoate
(2-hydroxycyclohexyl) 2,4,4-trimethylpent-2-enoate (PubChem CID 57070038) has the molecular formula C14H24O3
and a molecular weight of 240.34 g/mol. Its IUPAC name is (2-hydroxycyclohexyl) 2,4,4-trimethylpent-2-enoate.
Molecular Properties
| Compound Name | (2-hydroxycyclohexyl) 2,4,4-trimethylpent-2-enoate |
| PubChem CID | 57070038 |
| Molecular Formula | C14H24O3 |
| Molecular Weight | 240.34 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | (2-hydroxycyclohexyl) 2,4,4-trimethylpent-2-enoate |
| SMILES | CC(=CC(C)(C)C)C(=O)OC1CCCCC1O |
| InChI | InChI=1S/C14H24O3/c1-10(9-14(2,3)4)13(16)17-12-8-6-5-7-11(12)15/h9,11-12,15H,5-8H2,1-4H3 |
| InChIKey | AIGFAENNIFEMMC-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.34 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2-hydroxycyclohexyl) 2,4,4-trimethylpent-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-hydroxycyclohexyl) 2,4,4-trimethylpent-2-enoate?
The IUPAC name of (2-hydroxycyclohexyl) 2,4,4-trimethylpent-2-enoate (CID 57070038) is (2-hydroxycyclohexyl) 2,4,4-trimethylpent-2-enoate.
What is the SMILES notation for (2-hydroxycyclohexyl) 2,4,4-trimethylpent-2-enoate?
The canonical SMILES for (2-hydroxycyclohexyl) 2,4,4-trimethylpent-2-enoate is CC(=CC(C)(C)C)C(=O)OC1CCCCC1O.
What is the InChIKey of (2-hydroxycyclohexyl) 2,4,4-trimethylpent-2-enoate?
The InChIKey is AIGFAENNIFEMMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24O3/c1-10(9-14(2,3)4)13(16)17-12-8-6-5-7-11(12)15/h9,11-12,15H,5-8H2,1-4H3.
What are the key properties of (2-hydroxycyclohexyl) 2,4,4-trimethylpent-2-enoate?
(2-hydroxycyclohexyl) 2,4,4-trimethylpent-2-enoate has a molecular weight of 240.34 g/mol, XLogP of 2.83, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-hydroxycyclohexyl) 2,4,4-trimethylpent-2-enoate is sourced from PubChem (CID 57070038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).