About 2,2-diamino-3,7-dihydro-1H-purin-6-one
2,2-diamino-3,7-dihydro-1H-purin-6-one (PubChem CID 57070075) has the molecular formula C5H8N6O
and a molecular weight of 168.16 g/mol. Its IUPAC name is 2,2-diamino-3,7-dihydro-1H-purin-6-one.
Molecular Properties
| Compound Name | 2,2-diamino-3,7-dihydro-1H-purin-6-one |
| PubChem CID | 57070075 |
| Molecular Formula | C5H8N6O |
| Molecular Weight | 168.16 g/mol |
| Exact Mass | 168.08 |
| IUPAC Name | 2,2-diamino-3,7-dihydro-1H-purin-6-one |
| SMILES | NC1(N)NC(=O)c2[nH]cnc2N1 |
| InChI | InChI=1S/C5H8N6O/c6-5(7)10-3-2(4(12)11-5)8-1-9-3/h1,10H,6-7H2,(H,8,9)(H,11,12) |
| InChIKey | SRYGWTUNCQWTTA-UHFFFAOYSA-N |
| XLogP | -1.91 |
| TPSA | 121.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.16 |
| LogP ≤ 5 | -1.91 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2,2-diamino-3,7-dihydro-1H-purin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-diamino-3,7-dihydro-1H-purin-6-one?
The IUPAC name of 2,2-diamino-3,7-dihydro-1H-purin-6-one (CID 57070075) is 2,2-diamino-3,7-dihydro-1H-purin-6-one.
What is the SMILES notation for 2,2-diamino-3,7-dihydro-1H-purin-6-one?
The canonical SMILES for 2,2-diamino-3,7-dihydro-1H-purin-6-one is NC1(N)NC(=O)c2[nH]cnc2N1.
What is the InChIKey of 2,2-diamino-3,7-dihydro-1H-purin-6-one?
The InChIKey is SRYGWTUNCQWTTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N6O/c6-5(7)10-3-2(4(12)11-5)8-1-9-3/h1,10H,6-7H2,(H,8,9)(H,11,12).
What are the key properties of 2,2-diamino-3,7-dihydro-1H-purin-6-one?
2,2-diamino-3,7-dihydro-1H-purin-6-one has a molecular weight of 168.16 g/mol, XLogP of -1.91, 0 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-diamino-3,7-dihydro-1H-purin-6-one is sourced from PubChem (CID 57070075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).