C22H45NO2 — CID 57070237
3-amino-4-hexadec-7-enylhexane-1,6-diol (PubChem CID 57070237) has the molecular formula C22H45NO2 and a molecular weight of 355.61 g/mol. Its IUPAC name is 3-amino-4-hexadec-7-enylhexane-1,6-diol.
| Compound Name | 3-amino-4-hexadec-7-enylhexane-1,6-diol |
|---|---|
| PubChem CID | 57070237 |
| Molecular Formula | C22H45NO2 |
| Molecular Weight | 355.61 g/mol |
| Exact Mass | 355.35 |
| IUPAC Name | 3-amino-4-hexadec-7-enylhexane-1,6-diol |
| SMILES | CCCCCCCCC=CCCCCCCC(CCO)C(N)CCO |
| InChI | InChI=1S/C22H45NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-21(17-19-24)22(23)18-20-25/h9-10,21-22,24-25H,2-8,11-20,23H2,1H3 |
| InChIKey | JVWXTLSVXSYVEU-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.61 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|