C14H12FNO — CID 57070333
14-fluoro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3,6,12,14-pentaen-2-one (PubChem CID 57070333) has the molecular formula C14H12FNO and a molecular weight of 229.25 g/mol. Its IUPAC name is 14-fluoro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3,6,12,14-pentaen-2-one.
| Compound Name | 14-fluoro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3,6,12,14-pentaen-2-one |
|---|---|
| PubChem CID | 57070333 |
| Molecular Formula | C14H12FNO |
| Molecular Weight | 229.25 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 14-fluoro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3,6,12,14-pentaen-2-one |
| SMILES | O=C1C2=NCC=CC2CCc2ccc(F)cc21 |
| InChI | InChI=1S/C14H12FNO/c15-11-6-5-9-3-4-10-2-1-7-16-13(10)14(17)12(9)8-11/h1-2,5-6,8,10H,3-4,7H2 |
| InChIKey | PEYRZFSAGOQFND-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.25 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|