About 7-acetyldecane-2,5,9-trione
7-acetyldecane-2,5,9-trione (PubChem CID 57070336) has the molecular formula C12H18O4
and a molecular weight of 226.27 g/mol. Its IUPAC name is 7-acetyldecane-2,5,9-trione.
Molecular Properties
| Compound Name | 7-acetyldecane-2,5,9-trione |
| PubChem CID | 57070336 |
| Molecular Formula | C12H18O4 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | 7-acetyldecane-2,5,9-trione |
| SMILES | CC(=O)CCC(=O)CC(CC(C)=O)C(C)=O |
| InChI | InChI=1S/C12H18O4/c1-8(13)4-5-12(16)7-11(10(3)15)6-9(2)14/h11H,4-7H2,1-3H3 |
| InChIKey | YEIYJKJWOVWIAE-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-acetyldecane-2,5,9-trione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-acetyldecane-2,5,9-trione?
The IUPAC name of 7-acetyldecane-2,5,9-trione (CID 57070336) is 7-acetyldecane-2,5,9-trione.
What is the SMILES notation for 7-acetyldecane-2,5,9-trione?
The canonical SMILES for 7-acetyldecane-2,5,9-trione is CC(=O)CCC(=O)CC(CC(C)=O)C(C)=O.
What is the InChIKey of 7-acetyldecane-2,5,9-trione?
The InChIKey is YEIYJKJWOVWIAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O4/c1-8(13)4-5-12(16)7-11(10(3)15)6-9(2)14/h11H,4-7H2,1-3H3.
What are the key properties of 7-acetyldecane-2,5,9-trione?
7-acetyldecane-2,5,9-trione has a molecular weight of 226.27 g/mol, XLogP of 1.50, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-acetyldecane-2,5,9-trione is sourced from PubChem (CID 57070336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).