About 2-fluorocyclohexa-2,5-diene-1-carbonitrile
2-fluorocyclohexa-2,5-diene-1-carbonitrile (PubChem CID 57070342) has the molecular formula C7H6FN
and a molecular weight of 123.13 g/mol. Its IUPAC name is 2-fluorocyclohexa-2,5-diene-1-carbonitrile.
Molecular Properties
| Compound Name | 2-fluorocyclohexa-2,5-diene-1-carbonitrile |
| PubChem CID | 57070342 |
| Molecular Formula | C7H6FN |
| Molecular Weight | 123.13 g/mol |
| Exact Mass | 123.05 |
| IUPAC Name | 2-fluorocyclohexa-2,5-diene-1-carbonitrile |
| SMILES | N#CC1C=CCC=C1F |
| InChI | InChI=1S/C7H6FN/c8-7-4-2-1-3-6(7)5-9/h1,3-4,6H,2H2 |
| InChIKey | QUGJZIYICNBQLR-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.13 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-fluorocyclohexa-2,5-diene-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluorocyclohexa-2,5-diene-1-carbonitrile?
The IUPAC name of 2-fluorocyclohexa-2,5-diene-1-carbonitrile (CID 57070342) is 2-fluorocyclohexa-2,5-diene-1-carbonitrile.
What is the SMILES notation for 2-fluorocyclohexa-2,5-diene-1-carbonitrile?
The canonical SMILES for 2-fluorocyclohexa-2,5-diene-1-carbonitrile is N#CC1C=CCC=C1F.
What is the InChIKey of 2-fluorocyclohexa-2,5-diene-1-carbonitrile?
The InChIKey is QUGJZIYICNBQLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6FN/c8-7-4-2-1-3-6(7)5-9/h1,3-4,6H,2H2.
What are the key properties of 2-fluorocyclohexa-2,5-diene-1-carbonitrile?
2-fluorocyclohexa-2,5-diene-1-carbonitrile has a molecular weight of 123.13 g/mol, XLogP of 1.94, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluorocyclohexa-2,5-diene-1-carbonitrile is sourced from PubChem (CID 57070342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).