About cyclopentyl 9-(1,3-dioxoisoindol-2-yl)decanoate
cyclopentyl 9-(1,3-dioxoisoindol-2-yl)decanoate (PubChem CID 57070379) has the molecular formula C23H31NO4
and a molecular weight of 385.50 g/mol. Its IUPAC name is cyclopentyl 9-(1,3-dioxoisoindol-2-yl)decanoate.
Molecular Properties
| Compound Name | cyclopentyl 9-(1,3-dioxoisoindol-2-yl)decanoate |
| PubChem CID | 57070379 |
| Molecular Formula | C23H31NO4 |
| Molecular Weight | 385.50 g/mol |
| Exact Mass | 385.23 |
| IUPAC Name | cyclopentyl 9-(1,3-dioxoisoindol-2-yl)decanoate |
| SMILES | CC(CCCCCCCC(=O)OC1CCCC1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C23H31NO4/c1-17(24-22(26)19-14-9-10-15-20(19)23(24)27)11-5-3-2-4-6-16-21(25)28-18-12-7-8-13-18/h9-10,14-15,17-18H,2-8,11-13,16H2,1H3 |
| InChIKey | IAMSXTGUQMQJLP-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.50 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze cyclopentyl 9-(1,3-dioxoisoindol-2-yl)decanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopentyl 9-(1,3-dioxoisoindol-2-yl)decanoate?
The IUPAC name of cyclopentyl 9-(1,3-dioxoisoindol-2-yl)decanoate (CID 57070379) is cyclopentyl 9-(1,3-dioxoisoindol-2-yl)decanoate.
What is the SMILES notation for cyclopentyl 9-(1,3-dioxoisoindol-2-yl)decanoate?
The canonical SMILES for cyclopentyl 9-(1,3-dioxoisoindol-2-yl)decanoate is CC(CCCCCCCC(=O)OC1CCCC1)N1C(=O)c2ccccc2C1=O.
What is the InChIKey of cyclopentyl 9-(1,3-dioxoisoindol-2-yl)decanoate?
The InChIKey is IAMSXTGUQMQJLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H31NO4/c1-17(24-22(26)19-14-9-10-15-20(19)23(24)27)11-5-3-2-4-6-16-21(25)28-18-12-7-8-13-18/h9-10,14-15,17-18H,2-8,11-13,16H2,1H3.
What are the key properties of cyclopentyl 9-(1,3-dioxoisoindol-2-yl)decanoate?
cyclopentyl 9-(1,3-dioxoisoindol-2-yl)decanoate has a molecular weight of 385.50 g/mol, XLogP of 4.89, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopentyl 9-(1,3-dioxoisoindol-2-yl)decanoate is sourced from PubChem (CID 57070379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).