3,3-dimethylbutylsulfamic acid

C6H15NO3S — CID 57071357

IUPAC3,3-dimethylbutylsulfamic acid
SMILESCC(C)(C)CCNS(=O)(=O)O
InChIInChI=1S/C6H15NO3S/c1-6(2,3)4-5-7-11(8,9)10/h7H,4-5H2,1-3H3,(H,8,9,10)
InChIKeyNQJNRRQBZPUBLR-UHFFFAOYSA-N
MW181.26 g/mol
LogP0.81
Rot. Bonds3

About 3,3-dimethylbutylsulfamic acid

3,3-dimethylbutylsulfamic acid (PubChem CID 57071357) has the molecular formula C6H15NO3S and a molecular weight of 181.26 g/mol. Its IUPAC name is 3,3-dimethylbutylsulfamic acid.

Molecular Properties

Compound Name3,3-dimethylbutylsulfamic acid
PubChem CID57071357
Molecular FormulaC6H15NO3S
Molecular Weight181.26 g/mol
Exact Mass181.08
IUPAC Name3,3-dimethylbutylsulfamic acid
SMILESCC(C)(C)CCNS(=O)(=O)O
InChIInChI=1S/C6H15NO3S/c1-6(2,3)4-5-7-11(8,9)10/h7H,4-5H2,1-3H3,(H,8,9,10)
InChIKeyNQJNRRQBZPUBLR-UHFFFAOYSA-N
XLogP0.81
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500181.26
LogP ≤ 50.81
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 3,3-dimethylbutylsulfamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,3-dimethylbutylsulfamic acid?
The IUPAC name of 3,3-dimethylbutylsulfamic acid (CID 57071357) is 3,3-dimethylbutylsulfamic acid.
What is the SMILES notation for 3,3-dimethylbutylsulfamic acid?
The canonical SMILES for 3,3-dimethylbutylsulfamic acid is CC(C)(C)CCNS(=O)(=O)O.
What is the InChIKey of 3,3-dimethylbutylsulfamic acid?
The InChIKey is NQJNRRQBZPUBLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15NO3S/c1-6(2,3)4-5-7-11(8,9)10/h7H,4-5H2,1-3H3,(H,8,9,10).
What are the key properties of 3,3-dimethylbutylsulfamic acid?
3,3-dimethylbutylsulfamic acid has a molecular weight of 181.26 g/mol, XLogP of 0.81, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethylbutylsulfamic acid is sourced from PubChem (CID 57071357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).