C25H48O2Si2 — CID 57071558
[(1R,7aR)-7a-methyl-1-[(2R)-1-[(1S,4R)-4-methyl-4-trimethylsilyloxycyclopent-2-en-1-yl]propan-2-yl]-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]oxy-trimethylsilane (PubChem CID 57071558) has the molecular formula C25H48O2Si2 and a molecular weight of 436.83 g/mol. Its IUPAC name is [(1R,7aR)-7a-methyl-1-[(2R)-1-[(1S,4R)-4-methyl-4-trimethylsilyloxycyclopent-2-en-1-yl]propan-2-yl]-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]oxy-trimethylsilane.
| Compound Name | [(1R,7aR)-7a-methyl-1-[(2R)-1-[(1S,4R)-4-methyl-4-trimethylsilyloxycyclopent-2-en-1-yl]propan-2-yl]-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 57071558 |
| Molecular Formula | C25H48O2Si2 |
| Molecular Weight | 436.83 g/mol |
| Exact Mass | 436.32 |
| IUPAC Name | [(1R,7aR)-7a-methyl-1-[(2R)-1-[(1S,4R)-4-methyl-4-trimethylsilyloxycyclopent-2-en-1-yl]propan-2-yl]-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]oxy-trimethylsilane |
| SMILES | C[C@H](C[C@@H]1C=C[C@](C)(O[Si](C)(C)C)C1)[C@H]1CCC2C(O[Si](C)(C)C)CCC[C@@]21C |
| InChI | InChI=1S/C25H48O2Si2/c1-19(17-20-14-16-24(2,18-20)27-29(7,8)9)21-12-13-22-23(26-28(4,5)6)11-10-15-25(21,22)3/h14,16,19-23H,10-13,15,17-18H2,1-9H3/t19-,20+,21-,22?,23?,24+,25-/m1/s1 |
| InChIKey | OFVGYOOPWVZXNN-HBUFIOEKSA-N |
| XLogP | 7.64 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.83 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|