About 4,4-bis(methylsulfanyl)-2,3-dihydrochromene-6-carbaldehyde
4,4-bis(methylsulfanyl)-2,3-dihydrochromene-6-carbaldehyde (PubChem CID 57071560) has the molecular formula C12H14O2S2
and a molecular weight of 254.38 g/mol. Its IUPAC name is 4,4-bis(methylsulfanyl)-2,3-dihydrochromene-6-carbaldehyde.
Molecular Properties
| Compound Name | 4,4-bis(methylsulfanyl)-2,3-dihydrochromene-6-carbaldehyde |
| PubChem CID | 57071560 |
| Molecular Formula | C12H14O2S2 |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.04 |
| IUPAC Name | 4,4-bis(methylsulfanyl)-2,3-dihydrochromene-6-carbaldehyde |
| SMILES | CSC1(SC)CCOc2ccc(C=O)cc21 |
| InChI | InChI=1S/C12H14O2S2/c1-15-12(16-2)5-6-14-11-4-3-9(8-13)7-10(11)12/h3-4,7-8H,5-6H2,1-2H3 |
| InChIKey | KHFIUQAMORVZAO-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 4,4-bis(methylsulfanyl)-2,3-dihydrochromene-6-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-bis(methylsulfanyl)-2,3-dihydrochromene-6-carbaldehyde?
The IUPAC name of 4,4-bis(methylsulfanyl)-2,3-dihydrochromene-6-carbaldehyde (CID 57071560) is 4,4-bis(methylsulfanyl)-2,3-dihydrochromene-6-carbaldehyde.
What is the SMILES notation for 4,4-bis(methylsulfanyl)-2,3-dihydrochromene-6-carbaldehyde?
The canonical SMILES for 4,4-bis(methylsulfanyl)-2,3-dihydrochromene-6-carbaldehyde is CSC1(SC)CCOc2ccc(C=O)cc21.
What is the InChIKey of 4,4-bis(methylsulfanyl)-2,3-dihydrochromene-6-carbaldehyde?
The InChIKey is KHFIUQAMORVZAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O2S2/c1-15-12(16-2)5-6-14-11-4-3-9(8-13)7-10(11)12/h3-4,7-8H,5-6H2,1-2H3.
What are the key properties of 4,4-bis(methylsulfanyl)-2,3-dihydrochromene-6-carbaldehyde?
4,4-bis(methylsulfanyl)-2,3-dihydrochromene-6-carbaldehyde has a molecular weight of 254.38 g/mol, XLogP of 3.16, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-bis(methylsulfanyl)-2,3-dihydrochromene-6-carbaldehyde is sourced from PubChem (CID 57071560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).