About (1-ethylcyclohexyl)methyl 1-(4-cyano-3,5-difluorophenyl)cyclohexane-1-carboxylate
(1-ethylcyclohexyl)methyl 1-(4-cyano-3,5-difluorophenyl)cyclohexane-1-carboxylate (PubChem CID 57072040) has the molecular formula C23H29F2NO2
and a molecular weight of 389.49 g/mol. Its IUPAC name is (1-ethylcyclohexyl)methyl 1-(4-cyano-3,5-difluorophenyl)cyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | (1-ethylcyclohexyl)methyl 1-(4-cyano-3,5-difluorophenyl)cyclohexane-1-carboxylate |
| PubChem CID | 57072040 |
| Molecular Formula | C23H29F2NO2 |
| Molecular Weight | 389.49 g/mol |
| Exact Mass | 389.22 |
| IUPAC Name | (1-ethylcyclohexyl)methyl 1-(4-cyano-3,5-difluorophenyl)cyclohexane-1-carboxylate |
| SMILES | CCC1(COC(=O)C2(c3cc(F)c(C#N)c(F)c3)CCCCC2)CCCCC1 |
| InChI | InChI=1S/C23H29F2NO2/c1-2-22(9-5-3-6-10-22)16-28-21(27)23(11-7-4-8-12-23)17-13-19(24)18(15-26)20(25)14-17/h13-14H,2-12,16H2,1H3 |
| InChIKey | WIYMTEBKZNXSJM-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 389.49 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1-ethylcyclohexyl)methyl 1-(4-cyano-3,5-difluorophenyl)cyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-ethylcyclohexyl)methyl 1-(4-cyano-3,5-difluorophenyl)cyclohexane-1-carboxylate?
The IUPAC name of (1-ethylcyclohexyl)methyl 1-(4-cyano-3,5-difluorophenyl)cyclohexane-1-carboxylate (CID 57072040) is (1-ethylcyclohexyl)methyl 1-(4-cyano-3,5-difluorophenyl)cyclohexane-1-carboxylate.
What is the SMILES notation for (1-ethylcyclohexyl)methyl 1-(4-cyano-3,5-difluorophenyl)cyclohexane-1-carboxylate?
The canonical SMILES for (1-ethylcyclohexyl)methyl 1-(4-cyano-3,5-difluorophenyl)cyclohexane-1-carboxylate is CCC1(COC(=O)C2(c3cc(F)c(C#N)c(F)c3)CCCCC2)CCCCC1.
What is the InChIKey of (1-ethylcyclohexyl)methyl 1-(4-cyano-3,5-difluorophenyl)cyclohexane-1-carboxylate?
The InChIKey is WIYMTEBKZNXSJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H29F2NO2/c1-2-22(9-5-3-6-10-22)16-28-21(27)23(11-7-4-8-12-23)17-13-19(24)18(15-26)20(25)14-17/h13-14H,2-12,16H2,1H3.
What are the key properties of (1-ethylcyclohexyl)methyl 1-(4-cyano-3,5-difluorophenyl)cyclohexane-1-carboxylate?
(1-ethylcyclohexyl)methyl 1-(4-cyano-3,5-difluorophenyl)cyclohexane-1-carboxylate has a molecular weight of 389.49 g/mol, XLogP of 5.94, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1-ethylcyclohexyl)methyl 1-(4-cyano-3,5-difluorophenyl)cyclohexane-1-carboxylate is sourced from PubChem (CID 57072040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).