C14H19F3O9S — CID 57072286
[(3aR,4R,7S,7aS)-2-(deuteriomethyl)-4-[(4S)-2-(deuteriomethyl)-2-methyl-1,3-dioxolan-4-yl]-2-methyl-6-oxo-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-7-yl] trifluoromethanesulfonate (PubChem CID 57072286) has the molecular formula C14H19F3O9S and a molecular weight of 422.37 g/mol. Its IUPAC name is [(3aR,4R,7S,7aS)-2-(deuteriomethyl)-4-[(4S)-2-(deuteriomethyl)-2-methyl-1,3-dioxolan-4-yl]-2-methyl-6-oxo-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-7-yl] trifluoromethanesulfonate.
| Compound Name | [(3aR,4R,7S,7aS)-2-(deuteriomethyl)-4-[(4S)-2-(deuteriomethyl)-2-methyl-1,3-dioxolan-4-yl]-2-methyl-6-oxo-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-7-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 57072286 |
| Molecular Formula | C14H19F3O9S |
| Molecular Weight | 422.37 g/mol |
| Exact Mass | 422.08 |
| IUPAC Name | [(3aR,4R,7S,7aS)-2-(deuteriomethyl)-4-[(4S)-2-(deuteriomethyl)-2-methyl-1,3-dioxolan-4-yl]-2-methyl-6-oxo-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-7-yl] trifluoromethanesulfonate |
| SMILES | [2H]CC1(C)O[C@H]2[C@@H]([C@@H]3COC(C)(C[2H])O3)OC(=O)[C@@H](OS(=O)(=O)C(F)(F)F)[C@H]2O1 |
| InChI | InChI=1S/C14H19F3O9S/c1-12(2)21-5-6(23-12)7-8-9(25-13(3,4)24-8)10(11(18)22-7)26-27(19,20)14(15,16)17/h6-10H,5H2,1-4H3/t6-,7+,8-,9-,10-/m0/s1/i1D,3D/t6-,7+,8-,9-,10-,12?,13? |
| InChIKey | TWDRZYZFLITFQS-SVOMZOLCSA-N |
| XLogP | 0.82 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.37 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|