About methyl 7-[(2R,3S)-3-butoxy-1-hydroxy-2-(8-hydroxyoct-1-enyl)cyclopentyl]hept-2-enoate
methyl 7-[(2R,3S)-3-butoxy-1-hydroxy-2-(8-hydroxyoct-1-enyl)cyclopentyl]hept-2-enoate (PubChem CID 57072337) has the molecular formula C25H44O5
and a molecular weight of 424.62 g/mol. Its IUPAC name is methyl 7-[(2R,3S)-3-butoxy-1-hydroxy-2-(8-hydroxyoct-1-enyl)cyclopentyl]hept-2-enoate.
Molecular Properties
| Compound Name | methyl 7-[(2R,3S)-3-butoxy-1-hydroxy-2-(8-hydroxyoct-1-enyl)cyclopentyl]hept-2-enoate |
| PubChem CID | 57072337 |
| Molecular Formula | C25H44O5 |
| Molecular Weight | 424.62 g/mol |
| Exact Mass | 424.32 |
| IUPAC Name | methyl 7-[(2R,3S)-3-butoxy-1-hydroxy-2-(8-hydroxyoct-1-enyl)cyclopentyl]hept-2-enoate |
| SMILES | CCCCO[C@H]1CCC(O)(CCCCC=CC(=O)OC)[C@@H]1C=CCCCCCCO |
| InChI | InChI=1S/C25H44O5/c1-3-4-21-30-23-17-19-25(28,18-13-9-8-12-16-24(27)29-2)22(23)15-11-7-5-6-10-14-20-26/h11-12,15-16,22-23,26,28H,3-10,13-14,17-21H2,1-2H3/t22-,23+,25?/m1/s1 |
| InChIKey | WTAOEFUSNZBYKB-QRKINALSSA-N |
| XLogP | 5.10 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 424.62 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 7-[(2R,3S)-3-butoxy-1-hydroxy-2-(8-hydroxyoct-1-enyl)cyclopentyl]hept-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 7-[(2R,3S)-3-butoxy-1-hydroxy-2-(8-hydroxyoct-1-enyl)cyclopentyl]hept-2-enoate?
The IUPAC name of methyl 7-[(2R,3S)-3-butoxy-1-hydroxy-2-(8-hydroxyoct-1-enyl)cyclopentyl]hept-2-enoate (CID 57072337) is methyl 7-[(2R,3S)-3-butoxy-1-hydroxy-2-(8-hydroxyoct-1-enyl)cyclopentyl]hept-2-enoate.
What is the SMILES notation for methyl 7-[(2R,3S)-3-butoxy-1-hydroxy-2-(8-hydroxyoct-1-enyl)cyclopentyl]hept-2-enoate?
The canonical SMILES for methyl 7-[(2R,3S)-3-butoxy-1-hydroxy-2-(8-hydroxyoct-1-enyl)cyclopentyl]hept-2-enoate is CCCCO[C@H]1CCC(O)(CCCCC=CC(=O)OC)[C@@H]1C=CCCCCCCO.
What is the InChIKey of methyl 7-[(2R,3S)-3-butoxy-1-hydroxy-2-(8-hydroxyoct-1-enyl)cyclopentyl]hept-2-enoate?
The InChIKey is WTAOEFUSNZBYKB-QRKINALSSA-N. The full InChI is InChI=1S/C25H44O5/c1-3-4-21-30-23-17-19-25(28,18-13-9-8-12-16-24(27)29-2)22(23)15-11-7-5-6-10-14-20-26/h11-12,15-16,22-23,26,28H,3-10,13-14,17-21H2,1-2H3/t22-,23+,25?/m1/s1.
What are the key properties of methyl 7-[(2R,3S)-3-butoxy-1-hydroxy-2-(8-hydroxyoct-1-enyl)cyclopentyl]hept-2-enoate?
methyl 7-[(2R,3S)-3-butoxy-1-hydroxy-2-(8-hydroxyoct-1-enyl)cyclopentyl]hept-2-enoate has a molecular weight of 424.62 g/mol, XLogP of 5.10, 17 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 7-[(2R,3S)-3-butoxy-1-hydroxy-2-(8-hydroxyoct-1-enyl)cyclopentyl]hept-2-enoate is sourced from PubChem (CID 57072337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).