About 5-(oxan-2-yloxymethyl)-8-propan-2-ylcyclodeca-2,6-dien-1-one
5-(oxan-2-yloxymethyl)-8-propan-2-ylcyclodeca-2,6-dien-1-one (PubChem CID 57072361) has the molecular formula C19H30O3
and a molecular weight of 306.45 g/mol. Its IUPAC name is 5-(oxan-2-yloxymethyl)-8-propan-2-ylcyclodeca-2,6-dien-1-one.
Molecular Properties
| Compound Name | 5-(oxan-2-yloxymethyl)-8-propan-2-ylcyclodeca-2,6-dien-1-one |
| PubChem CID | 57072361 |
| Molecular Formula | C19H30O3 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.22 |
| IUPAC Name | 5-(oxan-2-yloxymethyl)-8-propan-2-ylcyclodeca-2,6-dien-1-one |
| SMILES | CC(C)C1C=CC(COC2CCCCO2)CC=CC(=O)CC1 |
| InChI | InChI=1S/C19H30O3/c1-15(2)17-10-9-16(6-5-7-18(20)12-11-17)14-22-19-8-3-4-13-21-19/h5,7,9-10,15-17,19H,3-4,6,8,11-14H2,1-2H3 |
| InChIKey | ZGZVKJVDTBXKAW-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-(oxan-2-yloxymethyl)-8-propan-2-ylcyclodeca-2,6-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(oxan-2-yloxymethyl)-8-propan-2-ylcyclodeca-2,6-dien-1-one?
The IUPAC name of 5-(oxan-2-yloxymethyl)-8-propan-2-ylcyclodeca-2,6-dien-1-one (CID 57072361) is 5-(oxan-2-yloxymethyl)-8-propan-2-ylcyclodeca-2,6-dien-1-one.
What is the SMILES notation for 5-(oxan-2-yloxymethyl)-8-propan-2-ylcyclodeca-2,6-dien-1-one?
The canonical SMILES for 5-(oxan-2-yloxymethyl)-8-propan-2-ylcyclodeca-2,6-dien-1-one is CC(C)C1C=CC(COC2CCCCO2)CC=CC(=O)CC1.
What is the InChIKey of 5-(oxan-2-yloxymethyl)-8-propan-2-ylcyclodeca-2,6-dien-1-one?
The InChIKey is ZGZVKJVDTBXKAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H30O3/c1-15(2)17-10-9-16(6-5-7-18(20)12-11-17)14-22-19-8-3-4-13-21-19/h5,7,9-10,15-17,19H,3-4,6,8,11-14H2,1-2H3.
What are the key properties of 5-(oxan-2-yloxymethyl)-8-propan-2-ylcyclodeca-2,6-dien-1-one?
5-(oxan-2-yloxymethyl)-8-propan-2-ylcyclodeca-2,6-dien-1-one has a molecular weight of 306.45 g/mol, XLogP of 4.28, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(oxan-2-yloxymethyl)-8-propan-2-ylcyclodeca-2,6-dien-1-one is sourced from PubChem (CID 57072361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).