C13H18N2 — CID 57072369
7-pyrrolidin-1-yl-6,7,8,8a-tetrahydroquinoline (PubChem CID 57072369) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is 7-pyrrolidin-1-yl-6,7,8,8a-tetrahydroquinoline.
| Compound Name | 7-pyrrolidin-1-yl-6,7,8,8a-tetrahydroquinoline |
|---|---|
| PubChem CID | 57072369 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | 7-pyrrolidin-1-yl-6,7,8,8a-tetrahydroquinoline |
| SMILES | C1=CC2=CCC(N3CCCC3)CC2N=C1 |
| InChI | InChI=1S/C13H18N2/c1-2-9-15(8-1)12-6-5-11-4-3-7-14-13(11)10-12/h3-5,7,12-13H,1-2,6,8-10H2 |
| InChIKey | OCUAEDXGPLXINK-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |