About 5-chloro-2-(2,4,5-trimethylphenyl)benzotriazole
5-chloro-2-(2,4,5-trimethylphenyl)benzotriazole (PubChem CID 57072452) has the molecular formula C15H14ClN3
and a molecular weight of 271.75 g/mol. Its IUPAC name is 5-chloro-2-(2,4,5-trimethylphenyl)benzotriazole.
Molecular Properties
| Compound Name | 5-chloro-2-(2,4,5-trimethylphenyl)benzotriazole |
| PubChem CID | 57072452 |
| Molecular Formula | C15H14ClN3 |
| Molecular Weight | 271.75 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | 5-chloro-2-(2,4,5-trimethylphenyl)benzotriazole |
| SMILES | Cc1cc(C)c(-n2nc3ccc(Cl)cc3n2)cc1C |
| InChI | InChI=1S/C15H14ClN3/c1-9-6-11(3)15(7-10(9)2)19-17-13-5-4-12(16)8-14(13)18-19/h4-8H,1-3H3 |
| InChIKey | OHYFNETYXUTJMI-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.75 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-chloro-2-(2,4,5-trimethylphenyl)benzotriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2-(2,4,5-trimethylphenyl)benzotriazole?
The IUPAC name of 5-chloro-2-(2,4,5-trimethylphenyl)benzotriazole (CID 57072452) is 5-chloro-2-(2,4,5-trimethylphenyl)benzotriazole.
What is the SMILES notation for 5-chloro-2-(2,4,5-trimethylphenyl)benzotriazole?
The canonical SMILES for 5-chloro-2-(2,4,5-trimethylphenyl)benzotriazole is Cc1cc(C)c(-n2nc3ccc(Cl)cc3n2)cc1C.
What is the InChIKey of 5-chloro-2-(2,4,5-trimethylphenyl)benzotriazole?
The InChIKey is OHYFNETYXUTJMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14ClN3/c1-9-6-11(3)15(7-10(9)2)19-17-13-5-4-12(16)8-14(13)18-19/h4-8H,1-3H3.
What are the key properties of 5-chloro-2-(2,4,5-trimethylphenyl)benzotriazole?
5-chloro-2-(2,4,5-trimethylphenyl)benzotriazole has a molecular weight of 271.75 g/mol, XLogP of 4.00, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2-(2,4,5-trimethylphenyl)benzotriazole is sourced from PubChem (CID 57072452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).