C6H8N3+ — CID 57072492
2,3-dihydro-1H-[1,2,4]triazolo[4,3-a]pyridin-4-ium (PubChem CID 57072492) has the molecular formula C6H8N3+ and a molecular weight of 122.15 g/mol. Its IUPAC name is 2,3-dihydro-1H-[1,2,4]triazolo[4,3-a]pyridin-4-ium.
| Compound Name | 2,3-dihydro-1H-[1,2,4]triazolo[4,3-a]pyridin-4-ium |
|---|---|
| PubChem CID | 57072492 |
| Molecular Formula | C6H8N3+ |
| Molecular Weight | 122.15 g/mol |
| Exact Mass | 122.07 |
| IUPAC Name | 2,3-dihydro-1H-[1,2,4]triazolo[4,3-a]pyridin-4-ium |
| SMILES | c1cc[n+]2c(c1)NNC2 |
| InChI | InChI=1S/C6H7N3/c1-2-4-9-5-7-8-6(9)3-1/h1-4,7H,5H2/p+1 |
| InChIKey | RMBMYDQNLFKZNV-UHFFFAOYSA-O |
| XLogP | -0.14 |
| TPSA | 27.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 122.15 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|