C36H33NO4S — CID 57072768
benzhydryl (4S,7S,12bR)-7-(benzoylsulfanylmethyl)-6-oxo-2,3,4,7,8,12b-hexahydro-1H-pyrido[2,1-a][2]benzazepine-4-carboxylate (PubChem CID 57072768) has the molecular formula C36H33NO4S and a molecular weight of 575.73 g/mol. Its IUPAC name is benzhydryl (4S,7S,12bR)-7-(benzoylsulfanylmethyl)-6-oxo-2,3,4,7,8,12b-hexahydro-1H-pyrido[2,1-a][2]benzazepine-4-carboxylate.
| Compound Name | benzhydryl (4S,7S,12bR)-7-(benzoylsulfanylmethyl)-6-oxo-2,3,4,7,8,12b-hexahydro-1H-pyrido[2,1-a][2]benzazepine-4-carboxylate |
|---|---|
| PubChem CID | 57072768 |
| Molecular Formula | C36H33NO4S |
| Molecular Weight | 575.73 g/mol |
| Exact Mass | 575.21 |
| IUPAC Name | benzhydryl (4S,7S,12bR)-7-(benzoylsulfanylmethyl)-6-oxo-2,3,4,7,8,12b-hexahydro-1H-pyrido[2,1-a][2]benzazepine-4-carboxylate |
| SMILES | O=C(SC[C@H]1Cc2ccccc2[C@H]2CCC[C@@H](C(=O)OC(c3ccccc3)c3ccccc3)N2C1=O)c1ccccc1 |
| InChI | InChI=1S/C36H33NO4S/c38-34-29(24-42-36(40)27-17-8-3-9-18-27)23-28-19-10-11-20-30(28)31-21-12-22-32(37(31)34)35(39)41-33(25-13-4-1-5-14-25)26-15-6-2-7-16-26/h1-11,13-20,29,31-33H,12,21-24H2/t29-,31-,32+/m1/s1 |
| InChIKey | SGQHBWUWYIWTNN-UVQPCEMDSA-N |
| XLogP | 7.19 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.73 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|