About 2-(2-ethyl-6,6-dimethylcyclohexen-1-yl)-N,N-dimethylethenamine
2-(2-ethyl-6,6-dimethylcyclohexen-1-yl)-N,N-dimethylethenamine (PubChem CID 57073015) has the molecular formula C14H25N
and a molecular weight of 207.36 g/mol. Its IUPAC name is 2-(2-ethyl-6,6-dimethylcyclohexen-1-yl)-N,N-dimethylethenamine.
Molecular Properties
| Compound Name | 2-(2-ethyl-6,6-dimethylcyclohexen-1-yl)-N,N-dimethylethenamine |
| PubChem CID | 57073015 |
| Molecular Formula | C14H25N |
| Molecular Weight | 207.36 g/mol |
| Exact Mass | 207.20 |
| IUPAC Name | 2-(2-ethyl-6,6-dimethylcyclohexen-1-yl)-N,N-dimethylethenamine |
| SMILES | CCC1=C(C=CN(C)C)C(C)(C)CCC1 |
| InChI | InChI=1S/C14H25N/c1-6-12-8-7-10-14(2,3)13(12)9-11-15(4)5/h9,11H,6-8,10H2,1-5H3 |
| InChIKey | RXPRBMCEYGUMEU-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.36 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(2-ethyl-6,6-dimethylcyclohexen-1-yl)-N,N-dimethylethenamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-ethyl-6,6-dimethylcyclohexen-1-yl)-N,N-dimethylethenamine?
The IUPAC name of 2-(2-ethyl-6,6-dimethylcyclohexen-1-yl)-N,N-dimethylethenamine (CID 57073015) is 2-(2-ethyl-6,6-dimethylcyclohexen-1-yl)-N,N-dimethylethenamine.
What is the SMILES notation for 2-(2-ethyl-6,6-dimethylcyclohexen-1-yl)-N,N-dimethylethenamine?
The canonical SMILES for 2-(2-ethyl-6,6-dimethylcyclohexen-1-yl)-N,N-dimethylethenamine is CCC1=C(C=CN(C)C)C(C)(C)CCC1.
What is the InChIKey of 2-(2-ethyl-6,6-dimethylcyclohexen-1-yl)-N,N-dimethylethenamine?
The InChIKey is RXPRBMCEYGUMEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25N/c1-6-12-8-7-10-14(2,3)13(12)9-11-15(4)5/h9,11H,6-8,10H2,1-5H3.
What are the key properties of 2-(2-ethyl-6,6-dimethylcyclohexen-1-yl)-N,N-dimethylethenamine?
2-(2-ethyl-6,6-dimethylcyclohexen-1-yl)-N,N-dimethylethenamine has a molecular weight of 207.36 g/mol, XLogP of 3.98, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-ethyl-6,6-dimethylcyclohexen-1-yl)-N,N-dimethylethenamine is sourced from PubChem (CID 57073015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).