About 4aH-pyrido[2,3-d]pyrimidin-4-one
4aH-pyrido[2,3-d]pyrimidin-4-one (PubChem CID 57073138) has the molecular formula C7H5N3O
and a molecular weight of 147.14 g/mol. Its IUPAC name is 4aH-pyrido[2,3-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 4aH-pyrido[2,3-d]pyrimidin-4-one |
| PubChem CID | 57073138 |
| Molecular Formula | C7H5N3O |
| Molecular Weight | 147.14 g/mol |
| Exact Mass | 147.04 |
| IUPAC Name | 4aH-pyrido[2,3-d]pyrimidin-4-one |
| SMILES | O=C1N=CN=C2N=CC=CC12 |
| InChI | InChI=1S/C7H5N3O/c11-7-5-2-1-3-8-6(5)9-4-10-7/h1-5H |
| InChIKey | SOKBSHYEHIOGDF-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 54.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.14 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4aH-pyrido[2,3-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4aH-pyrido[2,3-d]pyrimidin-4-one?
The IUPAC name of 4aH-pyrido[2,3-d]pyrimidin-4-one (CID 57073138) is 4aH-pyrido[2,3-d]pyrimidin-4-one.
What is the SMILES notation for 4aH-pyrido[2,3-d]pyrimidin-4-one?
The canonical SMILES for 4aH-pyrido[2,3-d]pyrimidin-4-one is O=C1N=CN=C2N=CC=CC12.
What is the InChIKey of 4aH-pyrido[2,3-d]pyrimidin-4-one?
The InChIKey is SOKBSHYEHIOGDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5N3O/c11-7-5-2-1-3-8-6(5)9-4-10-7/h1-5H.
What are the key properties of 4aH-pyrido[2,3-d]pyrimidin-4-one?
4aH-pyrido[2,3-d]pyrimidin-4-one has a molecular weight of 147.14 g/mol, XLogP of 0.21, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4aH-pyrido[2,3-d]pyrimidin-4-one is sourced from PubChem (CID 57073138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).