C17H20O7 — CID 57073273
(2S,3R,4R,5S,6R)-6-(hydroxymethyl)-5-methoxy-2-naphthalen-1-yloxane-2,3,4,5-tetrol (PubChem CID 57073273) has the molecular formula C17H20O7 and a molecular weight of 336.34 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-6-(hydroxymethyl)-5-methoxy-2-naphthalen-1-yloxane-2,3,4,5-tetrol.
| Compound Name | (2S,3R,4R,5S,6R)-6-(hydroxymethyl)-5-methoxy-2-naphthalen-1-yloxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 57073273 |
| Molecular Formula | C17H20O7 |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | (2S,3R,4R,5S,6R)-6-(hydroxymethyl)-5-methoxy-2-naphthalen-1-yloxane-2,3,4,5-tetrol |
| SMILES | CO[C@@]1(O)[C@H](O)[C@@H](O)[C@](O)(c2cccc3ccccc23)O[C@@H]1CO |
| InChI | InChI=1S/C17H20O7/c1-23-17(22)13(9-18)24-16(21,14(19)15(17)20)12-8-4-6-10-5-2-3-7-11(10)12/h2-8,13-15,18-22H,9H2,1H3/t13-,14-,15-,16+,17-/m1/s1 |
| InChIKey | PSYVRGYNMGLMPS-OVYGPGRDSA-N |
| XLogP | -0.57 |
| TPSA | 119.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|