C32H54O3SSi — CID 57073322
4-[[(9S,10R,13S,14S)-1-[tert-butyl(dimethyl)silyl]oxy-17-ethyl-10,13-dimethyl-2,3,4,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-3-yl]sulfanyl]-2-methylbutane-1,2-diol (PubChem CID 57073322) has the molecular formula C32H54O3SSi and a molecular weight of 546.93 g/mol. Its IUPAC name is 4-[[(9S,10R,13S,14S)-1-[tert-butyl(dimethyl)silyl]oxy-17-ethyl-10,13-dimethyl-2,3,4,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-3-yl]sulfanyl]-2-methylbutane-1,2-diol.
| Compound Name | 4-[[(9S,10R,13S,14S)-1-[tert-butyl(dimethyl)silyl]oxy-17-ethyl-10,13-dimethyl-2,3,4,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-3-yl]sulfanyl]-2-methylbutane-1,2-diol |
|---|---|
| PubChem CID | 57073322 |
| Molecular Formula | C32H54O3SSi |
| Molecular Weight | 546.93 g/mol |
| Exact Mass | 546.36 |
| IUPAC Name | 4-[[(9S,10R,13S,14S)-1-[tert-butyl(dimethyl)silyl]oxy-17-ethyl-10,13-dimethyl-2,3,4,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-3-yl]sulfanyl]-2-methylbutane-1,2-diol |
| SMILES | CCC1=CC[C@H]2C3=CC=C4CC(SCCC(C)(O)CO)CC(O[Si](C)(C)C(C)(C)C)[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C32H54O3SSi/c1-10-22-12-14-26-25-13-11-23-19-24(36-18-17-30(5,34)21-33)20-28(35-37(8,9)29(2,3)4)32(23,7)27(25)15-16-31(22,26)6/h11-13,24,26-28,33-34H,10,14-21H2,1-9H3/t24?,26-,27-,28?,30?,31+,32-/m0/s1 |
| InChIKey | ATIRBZVJMAUSAI-RSVYONAWSA-N |
| XLogP | 8.05 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.93 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|